- D-Altrose
-
-
2026-09-11
- CAS:1990-29-0
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | D-Altrose Basic information |
| Product Name: | D-Altrose | | Synonyms: | D-(+)-ALTROSE;ALTROSE, D-;ALTROSE, D-(RG);altrose;B-D-Altrose;D-ALTROSE extrapure for biochemistry;D(+)-Altrose,99%;D-ALTROSE, CRYSTALLIZED* | | CAS: | 1990-29-0 | | MF: | C6H12O6 | | MW: | 180.16 | | EINECS: | 217-870-4 | | Product Categories: | | | Mol File: | 1990-29-0.mol |  |
| | D-Altrose Chemical Properties |
| Melting point | 106-108 °C | | alpha | D20 +32.6° (c = 7.6) | | Boiling point | 232.96°C (rough estimate) | | density | 1.581 | | refractive index | 1.5860 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) | | form | Powder | | pka | 12.45±0.20(Predicted) | | color | White to off-white | | Optical Rotation | [α]/D 33.0±2.0°, c = 0.2 in H2O | | Merck | 13,319 | | BRN | 1724621 | | InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2 | | InChIKey | GZCGUPFRVQAUEE-UHFFFAOYSA-N | | SMILES | OC[C@H]1OC(O)[C@@H](O)[C@H](O)[C@@H]1O | | LogP | -3.290 (est) | | CAS DataBase Reference | 1990-29-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | D-Altrose Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | D-Altrose is the epimer of D-glucose at C3 and have recently been discovered to possess antioxidant properties by the suppression of reactive oxygen species production in mitochondria due to competiti
on with D-glucose at the cellular level. | | Definition | An aldohexose that is isomeric with glucose, tallose, allose, and others. | | Purification Methods | Crystallise D-altrose from aqueous EtOH. If it is obtained by the hydrolysis of the acetate, then it may contain sodium and acetate ions. Ions are best removed by dissolving in H2O, passing through suitable columns of ion-exchange resins, e.g. Amberlite IR-120 and Duolite A, and concentrating in a vacuum to a syrup. This is dissolved in MeOH, filtered and evaporated in a vacuum desiccator over granular CaCl2. The thick syrup is inoculated with seed crystals, stirred, and before it sets to a magma of crystals, transfer the crystals with MeOH to a Büchner funnel. Recrystallise them in the same way. -D-Altrofuranoside has initial [] D ~-69o (c 4, H2O) which mutarotates to +33o. [Richtmeyer Methods in Carbohydrate Chemistry I 107 Academic Press 1962, Beilstein 1 IV 4301, see Angyal Adv Carbohydrate Chem Biochem 42 15 1984 for ratio of anomers in solution.] |
| | D-Altrose Preparation Products And Raw materials |
|