|
|
| | Des(isopropoxyethyl) Bisoprolol Basic information |
| | Des(isopropoxyethyl) Bisoprolol Chemical Properties |
| Melting point | 72-75*C | | Boiling point | 413.2±40.0 °C(Predicted) | | density | 1.103±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.86±0.20(Predicted) | | color | Off-White to Light Beige | | Major Application | (Pharmaceutical small molecule) | | InChI | InChI=1S/C13H21NO3/c1-10(2)14-7-12(16)9-17-13-5-3-11(8-15)4-6-13/h3-6,10,12,14-16H,7-9H2,1-2H3 | | InChIKey | XWWMQUXRXOEXDS-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(OCC(O)CNC(C)C)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Des(isopropoxyethyl) Bisoprolol Usage And Synthesis |
| Uses | Des(isopropoxyethyl) Bisoprolol (Bisoprolol EP Impurity A) is a metabolite of Metoprolol and Bisoprolol. |
| | Des(isopropoxyethyl) Bisoprolol Preparation Products And Raw materials |
|