|
|
| | 1,1'-Methylene Bis[TheobroMine] Basic information |
| Product Name: | 1,1'-Methylene Bis[TheobroMine] | | Synonyms: | 1,1'-Methylene Bis[TheobroMine];1,1'-Methylenebis[3,7-dihydro-3,7-diMethyl-1H-purine-2,6-dione;Pentoxifylline EP impurity E;Pentoxifylline Impurity 5(Pentoxifylline EP Impurity E);1-[(3,7-dimethyl-2,6-dioxopurin-1-yl)methyl]-3,7-dimethylpurine-2,6-dione;1H-Purine-2,6-dione, 1,1'-methylenebis[3,7-dihydro-3,7-dimethyl-;1,1'-methylenebis(3,7-dimethyl-1H-purine-2,6(3H,7H)-dione);Pentoxifylline Impurity 5(Pentoxifylline EP Impurity A) | | CAS: | 77196-87-3 | | MF: | C15H16N8O4 | | MW: | 372.34 | | EINECS: | | | Product Categories: | Pharmaceuticals;Intermediates & Fine Chemicals;Impurities;Heterocycles | | Mol File: | 77196-87-3.mol | ![1,1'-Methylene Bis[TheobroMine] Structure](CAS/GIF/77196-87-3.gif) |
| | 1,1'-Methylene Bis[TheobroMine] Chemical Properties |
| Melting point | >300oC (dec.) | | Boiling point | 727.1±70.0 °C(Predicted) | | density | 1.69±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | TFA (Slightly) | | form | Solid | | pka | 0.65±0.70(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C15H16N8O4/c1-18-5-16-10-8(18)12(24)22(14(26)20(10)3)7-23-13(25)9-11(17-6-19(9)2)21(4)15(23)27/h5-6H,7H2,1-4H3 | | InChIKey | JQLBZHMVLVGVBB-UHFFFAOYSA-N | | SMILES | C(N1C(=O)C2=C(N(C)C1=O)N=CN2C)N1C(=O)C2=C(N(C)C1=O)N=CN2C |
| | 1,1'-Methylene Bis[TheobroMine] Usage And Synthesis |
| Uses | 1,1’-Methylene Bis[Theobromine] (Pentoxifylline EP Impurity E) is a Pentoxifylline (P276500) impurity. |
| | 1,1'-Methylene Bis[TheobroMine] Preparation Products And Raw materials |
|