- Eliglustat
-
- $9.80
-
2020-01-09
- CAS:491833-29-5
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | Eliglustat Basic information |
| Product Name: | Eliglustat | | Synonyms: | Eliglustat;Genz 99067;N-[(1R,2R)-2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-hydroxy-1-(1-pyrrolidinylmethyl)ethyl]-octanamide;GENZ-99067;GENZ99067;GENZ 99067;ELIGLUSTAT TARTRATE;GENZ-112638;N-[(1R,2R)-1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(1-
pyrrolidinyl)-2-propanyl]octanamide;Eliglustat(Genz-99067);Eliglustat(GENZ 112638);GENZ-99067; GENZ99067; GENZ 99067 | | CAS: | 491833-29-5 | | MF: | C23H36N2O4 | | MW: | 404.54 | | EINECS: | | | Product Categories: | | | Mol File: | 491833-29-5.mol |  |
| | Eliglustat Chemical Properties |
| Melting point | 87-92°C | | Boiling point | 615.5±55.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.45±0.20(Predicted) | | color | White to Off-White | | InChIKey | FJZZPCZKBUKGGU-AUSIDOKSSA-N | | SMILES | N3(CCCC3)C[C@@H](NC(=O)CCCCCCC)[C@H](O)c1cc2c(cc1)OCCO2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral STOT RE 2 |
| | Eliglustat Usage And Synthesis |
| Uses | Eliglustat is a specific and potent inhibitor of glucosylceramide synthase. | | Definition | ChEBI: A carboxamide obtained by formal condensation of the carboxy group of octanoic acid with the primary amino group of (1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(pyrrolidin-1-yl)propan-1-ol. A ceramide glucosyltr
nsferase inhibitor used (as its tartrate salt) for treatment of Gaucher's disease. | | Biological Activity | Eliglust at is a potent and selctive glucosylceramide synthase inhibitor approved for treatment of type 1 Gaucher disease. | | in vivo | Mice that received drug prior to significant accumulation of substrate (10 weeks of age) showed reduced levels of glucosylceramide and number of Gaucher cells in the spleen, lung and liver when compared to age-matched control animals[1]. |
| | Eliglustat Preparation Products And Raw materials |
|