|
|
| | Vinyltris(methylethylketoxime)silane Basic information | | Description |
| | Vinyltris(methylethylketoxime)silane Chemical Properties |
| Melting point | -22°C | | Boiling point | 115 °C | | density | 0.982 | | vapor pressure | 0.034Pa at 25℃ | | refractive index | 1.4543-1.4553 | | Fp | 90°C | | Specific Gravity | 0.982 | | Water Solubility | 36.63g/L | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C14H27N3O3Si/c1-8-12(5)15-18-21(11-4,19-16-13(6)9-2)20-17-14(7)10-3/h11H,4,8-10H2,1-3,5-7H3/b15-12+,16-13+,17-14+ | | InChIKey | WXWYJCSIHQKADM-ZNAKCYKMSA-N | | SMILES | [Si](C=C)(O/N=C(\C)/CC)(O/N=C(\C)/CC)O/N=C(\C)/CC | | LogP | 1.69 | | CAS DataBase Reference | 2224-33-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-Butanone, O,O',O''-(ethenylsilylidyne)trioxime (2224-33-1) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 1993 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III |
| | Vinyltris(methylethylketoxime)silane Usage And Synthesis |
| Description | Vinyl Tris(methylethylketoxime)silane (VOS) is a clear and almost colorless fluid with a typical smell (MEKO). It readily hydrolyzes upon contact with moisture.
It is used as a neutral curing agent in silicone sealant formulations. In most cases Vinyl Tris(methylethylketoxime)silane is used in combination with METHYLTRIS(METHYLETHYLKETOXIME)SILANE. Compared to formulations based on methyloxime silanes only, the use of combinations containing methyl- and vinyloxime silanes leads to a shorter skin formation time of the silicone sealant without a reduction of the curing time. The ability of the sealant to withstand stress early, required for a certain elasticity and tear resistance, is achieved.
| | Chemical Properties | Colorless or yellowish transparent liquid | | Flammability and Explosibility | Not classified |
| | Vinyltris(methylethylketoxime)silane Preparation Products And Raw materials |
|