- L-CYCLOPROPYLALANINE
-
- $7.00
-
2019-07-06
- CAS: 102735-53-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100KG
|
| | L-Cyclopropylalanine Basic information |
| | L-Cyclopropylalanine Chemical Properties |
| Boiling point | 258.0±23.0 °C(Predicted) | | density | 1.218±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 2.32±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1/C6H11NO2/c7-5(6(8)9)3-4-1-2-4/h4-5H,1-3,7H2,(H,8,9)/t5-/s3 | | InChIKey | XGUXJMWPVJQIHI-GQMHJJTINA-N | | SMILES | [C@H](N)(CC1CC1)C(=O)O |&1:0,r| | | CAS DataBase Reference | 102735-53-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 2922498590 |
| | L-Cyclopropylalanine Usage And Synthesis |
| Uses | 3-Cyclopropyl-L-alanine is used to prepare optically active pyrrolidineacetic acids as CCR5 receptor antagonists with antiviral activity against HIV. | | Synthesis | L-cyclopropylalanine can be prepared from cyclopropyl formaldehyde and N-benzoylglycine in a six-step reaction. |
| | L-Cyclopropylalanine Preparation Products And Raw materials |
|