D-Cyclopropylalanine manufacturers
- D-CYCLOPROPYLALANINE
-
- $3.00
-
2019-07-06
- CAS:121786-39-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | D-Cyclopropylalanine Basic information |
| | D-Cyclopropylalanine Chemical Properties |
| Boiling point | 258.0±23.0 °C(Predicted) | | density | 1.218±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.32±0.10(Predicted) | | InChI | InChI=1/C6H11NO2/c7-5(6(8)9)3-4-1-2-4/h4-5H,1-3,7H2,(H,8,9)/t5-/s3 | | InChIKey | XGUXJMWPVJQIHI-GQMHJJTINA-N | | SMILES | [C@@H](N)(CC1CC1)C(=O)O |&1:0,r| | | CAS DataBase Reference | 121786-39-8(CAS DataBase Reference) |
| | D-Cyclopropylalanine Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | D-Cyclopropylalanine is used in the synthesis of heterocyclo-fused [1,3]oxazepines and -thiazepines and analogs as inhibitors of neutral endopeptidase and angiotensin converting enzyme. |
| | D-Cyclopropylalanine Preparation Products And Raw materials |
|