(S)-(-)-2-Methoxypropionic acid manufacturers
|
| | (S)-(-)-2-Methoxypropionic acid Basic information |
| Product Name: | (S)-(-)-2-Methoxypropionic acid | | Synonyms: | (S)-(+)-2-METHOXYPROPIONIC ACID;RARECHEM AL BO 1222;(S)-(-)-2-Methoxypropionic acid,98%;(2S)-2-Methoxy-propanoic Acid;propanoic acid, 2-methoxy-, (2s)-;(S)-2-methoxypropanoic acid - [M11053];(S)-2-Methoxypropanoic acid;(S)-(-)-2-Methoxypropionic acid | | CAS: | 23953-00-6 | | MF: | C4H8O3 | | MW: | 104.1 | | EINECS: | | | Product Categories: | Chiral Reagents | | Mol File: | 23953-00-6.mol |  |
| | (S)-(-)-2-Methoxypropionic acid Chemical Properties |
| Melting point | 124-125 °C | | Boiling point | 99°C/20mmHg | | density | 1.1141 (rough estimate) | | refractive index | 1.4132-1.4152 | | storage temp. | Refrigerator | | solubility | Chloroform, Ethyl Acetate, Methanol | | pka | 3.59±0.10(Predicted) | | form | Liquid | | color | Clear slightly yellow | | InChI | InChI=1S/C4H8O3/c1-3(7-2)4(5)6/h3H,1-2H3,(H,5,6)/t3-/m0/s1 | | InChIKey | ICPWFHKNYYRBSZ-VKHMYHEASA-N | | SMILES | C(O)(=O)[C@@H](OC)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41 | | Safety Statements | 37/39-26-39 | | WGK Germany | WGK 3 | | HS Code | 29189990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 |
| Provider | Language |
|
ACROS
| English |
| | (S)-(-)-2-Methoxypropionic acid Usage And Synthesis |
| Chemical Properties | Liquid | | Uses | (S)-(-)-2-Methoxypropionic Acid (cas# 23953-00-6) is a compound useful in organic synthesis. |
| | (S)-(-)-2-Methoxypropionic acid Preparation Products And Raw materials |
|