| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
FAM alkyne, 5-isomer manufacturers
- 5-FAM alkyne
-
-
2025-06-07
- CAS:510758-19-7
- Min. Order: 5mg
- Purity: >97.00%
- Supply Ability: 5mg
|
| | FAM alkyne, 5-isomer Basic information |
| Product Name: | FAM alkyne, 5-isomer | | Synonyms: | FAM alkyne, 5-isomer;3',6'-Dihydroxy-3-oxo-N-(prop-2-yn-1-yl)-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carboxamide;FAMalkyne,5-isomer, >97%;Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-5-carboxamide, 3',6'-dihydroxy-3-oxo-N-2-propyn-1-yl-;5-isomer;5-fam YNE;FITC-Alkyne | | CAS: | 510758-19-7 | | MF: | C24H15NO6 | | MW: | 413.38 | | EINECS: | | | Product Categories: | | | Mol File: | 510758-19-7.mol |  |
| | FAM alkyne, 5-isomer Chemical Properties |
| Melting point | 313 °C(dec.) | | Boiling point | 709.6±60.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Soluble in DMSO, DMF, DCM | | pka | 9.32±0.20(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | Appearance | yellow solid | | InChI | InChI=1S/C24H15NO6/c1-2-9-25-22(28)13-3-6-17-16(10-13)23(29)31-24(17)18-7-4-14(26)11-20(18)30-21-12-15(27)5-8-19(21)24/h1,3-8,10-12,26-27H,9H2,(H,25,28) | | InChIKey | UNBAJBIGCBVWJU-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(O)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=C(C(NCC#C)=O)C=C1)C(=O)O2 |
| | FAM alkyne, 5-isomer Usage And Synthesis |
| Description | FAM (fluorescein) alkyne is a high purity (95%) 5-isomer with significant aqueous solubility. Alkyne enables copper-catalyzed Click chemistry. | | Uses | 5-FAM-Alkyne is a high selective and sensitive fluorescent biosensor for alkaline phosphatase (ALP)[1]. 5-FAM-Alkyne is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | | References | [1] Mengmeng Zhao, et al. A Sensitive Fluorescence Biosensor for Alkaline Phosphatase Activity Based on the Cu(II)-dependent DNAzyme. Anal Chim Acta. 2016 Dec 15;948:98-103. DOI:10.1016/j.aca.2016.10.033 | | Abs/Em Maxima | 492/517 nm | | Fluoresene quantum yield | 0.93 | | Extinction Coefficient | 74000 | | CF260 | 0.22 | | CF280 | 0.17 |
| | FAM alkyne, 5-isomer Preparation Products And Raw materials |
|