| Company Name: |
Zhengzhou Acme Chemical Co., Ltd.
|
| Tel: |
0371-63315541 13323832564 |
| Email: |
3001332135@qq.com |
| Products Intro: |
Product Name:2-Bromo-benzene-1,3,5-tricarboxylic acid CAS:13520-03-1 Purity:98% Package:1g;5g;10g
|
| Company Name: |
Zhengzhou anmousse chemical products co. LTD
|
| Tel: |
0371-55289822 18737195735 |
| Email: |
483339295@qq.com |
| Products Intro: |
Product Name:2-Bromo-benzene-1,3,5-tricarboxylic acid CAS:13520-03-1 Purity:98% Package:5g;10g;25g;50g;100g
|
|
| | 2-Bromo-benzene-1,3,5-tricarboxylic acid Basic information |
| | 2-Bromo-benzene-1,3,5-tricarboxylic acid Chemical Properties |
| InChI | 1S/C9H5BrO6/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16) | | InChIKey | FLDATZLQLJIBDG-UHFFFAOYSA-N | | SMILES | Brc1c(cc(cc1C(=O)O)C(=O)O)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Bromo-benzene-1,3,5-tricarboxylic acid Usage And Synthesis |
| | 2-Bromo-benzene-1,3,5-tricarboxylic acid Preparation Products And Raw materials |
|