|
|
| | 4,4,4-Trifluoro-1-phenyl-1,3-butanedione Basic information |
| Product Name: | 4,4,4-Trifluoro-1-phenyl-1,3-butanedione | | Synonyms: | TRIFLUORO-1-PHENYL-1,3-BUTANEDIONE;1,1,1-Trifluoro-4-phenyl-2,4-butanedione;1-Benzoyl-3,3,3-trifluoro-2-propanone;1-Benzoyl-3,3,3-trifluoroacetone;4,4,4-Trifluoro-1-phenylbutane-1,3-dione ,98%;ω-(Trifluoroacetyl)acetophenone;4,4,4-Trifluoro-1-phenyl-1,3-butanedione,99%;4-Phenyl-1,1,1-trifluorobuta | | CAS: | 326-06-7 | | MF: | C10H7F3O2 | | MW: | 216.16 | | EINECS: | 206-307-8 | | Product Categories: | organofluorine compounds;Miscellaneous | | Mol File: | 326-06-7.mol |  |
| | 4,4,4-Trifluoro-1-phenyl-1,3-butanedione Chemical Properties |
| Melting point | 38-40 °C(lit.) | | Boiling point | 224 °C(lit.) | | density | 1,113 g/cm3 | | Fp | 210 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | 95% ethanol: soluble25mg/mL, clear, colorless to yellow | | form | Crystalline Low Melting Solid | | pka | pK1: 6.35 (25°C) | | color | White to yellow | | Water Solubility | Sparingly Soluble in water (0.24 g/L) (25°C). | | BRN | 1875083 | | InChI | InChI=1S/C10H7F3O2/c11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7/h1-5H,6H2 | | InChIKey | VVXLFFIFNVKFBD-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CC(=O)C(F)(F)F | | CAS DataBase Reference | 326-06-7(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Butanedione, 4,4,4-trifluoro-1-phenyl- (326-06-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | T | | HazardClass | IRRITANT | | HS Code | 29147000 |
| | 4,4,4-Trifluoro-1-phenyl-1,3-butanedione Usage And Synthesis |
| Chemical Properties | WHITE TO YELLOW CRYSTALLINE LOW MELTING SOLID | | Uses | 4,4,4-Trifluoro-1-phenyl-1,3-butanedione was used in the synthesis of series of NNO ketoimines bearing trifluoromethyl substituents via Schiff base condensation reaction. It was also used in mixed-ligand chelate extraction of trivalent lanthanides and as a ligand in the preparation of ternary lanthanide (Ln) complexes. |
| | 4,4,4-Trifluoro-1-phenyl-1,3-butanedione Preparation Products And Raw materials |
|