|
|
| | Tenofovir impurity E Basic information |
| Product Name: | Tenofovir impurity E | | Synonyms: | RKTDGEHXFPNCDC-MRVPVSSYSA-N;ethyl hydrogen ((((R)-1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonate;Tenofovir ethyl;Tenofovir alafenamide-26;Phosphonic acid, P-[[(1R)-2-(6-amino-9H-purin-9-yl)-1-methylethoxy]methyl]-, monoethyl ester;Ethyl Tenofovir;EthylTenofovirAmmoniumSalt;ethyl hydrogen ((((R)-1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonate? (Tenofovir Impurity） | | CAS: | 1796545-19-1 | | MF: | C11H18N5O4P | | MW: | 315.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1796545-19-1.mol |  |
| | Tenofovir impurity E Chemical Properties |
| Boiling point | 548.8±60.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | pka | 2.54±0.10(Predicted) | | InChI | InChI=1S/C11H18N5O4P/c1-3-20-21(17,18)7-19-8(2)4-16-6-15-9-10(12)13-5-14-11(9)16/h5-6,8H,3-4,7H2,1-2H3,(H,17,18)(H2,12,13,14)/t8-/m1/s1 | | InChIKey | RKTDGEHXFPNCDC-MRVPVSSYSA-N | | SMILES | P(CO[C@H](C)CN1C2C(N=C1)=C(N)N=CN=2)(=O)(O)OCC |
| | Tenofovir impurity E Usage And Synthesis |
| Uses | Ethyl Tenofovir is an intermediate used in the improved synthesis of tenofovir disoproxil fumarate. Tenofovir (T018500 ) impurity, used as an anti-HIV agent. An antiviral. |
| | Tenofovir impurity E Preparation Products And Raw materials |
|