| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,2,3,4-TETRA-O-ACETYL-BETA-D-XYLOPYRANOSE Basic information |
| Product Name: | 1,2,3,4-TETRA-O-ACETYL-BETA-D-XYLOPYRANOSE | | Synonyms: | BETA D-XYLOSE TETRAACETATE;1,2,3,4-TETRA-O-ACETYL-BETA-D-XYLOPYRANOSE;1,2,3,4-Tetra-O-acetyl-b-D-xylopyranose;1,2,3,4-TETRA-O-ACETYL-SS-D-XYLOPYRANOSE;beta-D-Xylopyranose tetraacetate;b-D-Xylopyranose,1,2,3,4-tetraacetate;1,2,3,4-Tetra-O-acetyl-D-xylopyranose(β forM);1,2,3,4-O-Tetra-acetyl-β-D-xylopyranose | | CAS: | 4049-33-6 | | MF: | C13H18O9 | | MW: | 318.28 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 4049-33-6.mol |  |
| | 1,2,3,4-TETRA-O-ACETYL-BETA-D-XYLOPYRANOSE Chemical Properties |
| Melting point | 123-125 °C | | Boiling point | 362.9±42.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | InChI | InChI=1/C13H18O9/c1-6(14)19-10-5-18-13(22-9(4)17)12(21-8(3)16)11(10)20-7(2)15/h10-13H,5H2,1-4H3/t10-,11+,12-,13+/s3 | | InChIKey | MJOQJPYNENPSSS-WHTLBTNSNA-N | | SMILES | [C@H]1(OC(=O)C)[C@@H](CO[C@@H](OC(=O)C)[C@@H]1OC(=O)C)OC(=O)C |&1:0,5,8,13,r| |
| | 1,2,3,4-TETRA-O-ACETYL-BETA-D-XYLOPYRANOSE Usage And Synthesis |
| Uses | 1,2,3,4-Tetra-O-acetyl-β-D-xylopyranose is a useful research chemical compound used in the selective cleavage by hydrazine of the anomeric acetyl groups of acetylated glycosyl residues. |
| | 1,2,3,4-TETRA-O-ACETYL-BETA-D-XYLOPYRANOSE Preparation Products And Raw materials |
|