|
|
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranose Basic information |
| Product Name: | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranose | | Synonyms: | TETRA-O-ACETYL-B-D-GLUCOPYRANOSE, 1,2,3,4-;BETA-D-GLUCOSE-2,3,4,5-TETRAACETATE;1,2,3,4-TETRAACETYL-BETA-D-GLUCOPYRANOSE;1,2,3,4-TETRA-O-ACETYL-BETA-D-GLUCOPYRANOSE;1,2,3,4-tetra-O-acetyl-B-D-*glucopyranose;beta-D-glucose 1,2,3,4-tetraacetate;1,2,3,4-Tetra-O-acetyl-beta-D-;1,2,3,4-TETRA-O-ACETYL-SS-D-GLUCOPYRANOSE | | CAS: | 13100-46-4 | | MF: | C14H20O10 | | MW: | 348.3 | | EINECS: | 236-018-2 | | Product Categories: | Carbohydrates;Carbohydrate Synthesis;Monosaccharides;Specialty Synthesis;Sugars, Carbohydrates & Glucosides | | Mol File: | 13100-46-4.mol |  |
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranose Chemical Properties |
| Melting point | 126-128 °C(lit.) | | Boiling point | 0.120 °C(Press: 0.0001 Torr) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in chloroform | | pka | 14.48±0.10(Predicted) | | form | Powder | | color | White to Off-white | | Optical Rotation | [α]20/D +11°, c = 6 in chloroform | | InChI | InChI=1/C14H20O10/c1-6(16)20-11-10(5-15)24-14(23-9(4)19)13(22-8(3)18)12(11)21-7(2)17/h10-15H,5H2,1-4H3/t10-,11-,12+,13-,14-/s3 | | InChIKey | FEQXFAYSNRWXDW-JOAVLQHANA-N | | SMILES | O([C@H]1[C@@H]([C@@H](CO)O[C@@H](OC(=O)C)[C@@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,7,12,r| | | LogP | 1.140 (est) | | CAS DataBase Reference | 13100-46-4(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranose Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranose has been used in the study of substrates for inositol synthase, and for the preparation of anionic surfactants. |
| | 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranose Preparation Products And Raw materials |
|