|
|
| | CI 52041 Basic information |
| | CI 52041 Chemical Properties |
| Melting point | 216 °C | | Boiling point | 429.6±45.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | Insoluble in water, soluble in ethanol | | Colour Index | 52041 | | pka | 5.10±0.20(Predicted) | | form | Powder | | color | Dark green | | Water Solubility | soluble, clear | | λmax | 580 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | Biological Applications | Detecting microorganisms; medical devices | | InChI | 1S/C14H12N2OS/c1-16(2)9-3-5-11-13(7-9)18-14-8-10(17)4-6-12(14)15-11/h3-8H,1-2H3 | | InChIKey | ALJHHTHBYJROOG-UHFFFAOYSA-N | | SMILES | CN(C)c1ccc2N=C3C=CC(=O)C=C3Sc2c1 | | EPA Substance Registry System | 3H-Phenothiazin-3-one, 7-(dimethylamino)- (2516-05-4) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 32041900 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | CI 52041 Usage And Synthesis |
| Chemical Properties | dark green powder | | Uses | diagnostic assay manufacturing
hematology
histology |
| | CI 52041 Preparation Products And Raw materials |
|