|
|
| | PHENOL BLUE Basic information |
| Product Name: | PHENOL BLUE | | Synonyms: | PHENOL BLUE;N,N-DIMETHYLINDOANILINE;4-[[4-(Dimethylamino)phenyl]imino]-2,5-cyclohexadien-1-one;4-[p-(Dimethylamino)phenylimino]-2,5-cyclohexadien-1-one;N-[4-(Dimethylamino)phenyl]-1,4-benzoquinone imine;N,N-Dimethylindoaniline,78%,pract.;N,N-DimethylindoanilinePhenol blue;4-((4-(dimethylamino)phenyl)imino)-5-cyclohexadien-1-one | | CAS: | 2150-58-5 | | MF: | C14H14N2O | | MW: | 226.27 | | EINECS: | 218-434-6 | | Product Categories: | | | Mol File: | 2150-58-5.mol |  |
| | PHENOL BLUE Chemical Properties |
| Melting point | 133-134 °C | | Boiling point | 367.89°C (rough estimate) | | density | 1.0852 (rough estimate) | | refractive index | 1.6419 (estimate) | | storage temp. | room temp | | form | powder | | pka | 6.12±0.24(Predicted) | | λmax | 608 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C14H14N2O/c1-16(2)13-7-3-11(4-8-13)15-12-5-9-14(17)10-6-12/h3-10H,1-2H3 | | InChIKey | LHGMHYDJNXEEFG-UHFFFAOYSA-N | | SMILES | CN(C)c1ccc(cc1)N=C2C=CC(=O)C=C2 | | EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 4-[[4-(dimethylamino)phenyl]imino]- (2150-58-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-37/39-26 | | WGK Germany | 3 | | RTECS | GU5530000 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,80mg/kg (80mg/kg),Journal of Medicinal Chemistry. Vol. 21, Pg. 11, 1978. |
| Provider | Language |
|
ACROS
| English |
| | PHENOL BLUE Usage And Synthesis |
| Chemical Properties | Dark brown to black fine crystalline powder | | Uses | N,N-Dimethylindoaniline is an organic dye compound. Dyes and metabolites. |
| | PHENOL BLUE Preparation Products And Raw materials |
|