|
|
| | Tris-(4-aminophenyl)thiophosphate Basic information |
| Product Name: | Tris-(4-aminophenyl)thiophosphate | | Synonyms: | Thionophosphoric acid- tris-( p-aMinophenyl ester )TPTA;O,O,O-tris(4-aMinophenyl) phosphorothioate;Phenol,4-amino-,phosphorothioate(3:1)ester;Tris-(4-aminophenyl)-phosphorothioate;Thiophosphoric acid=O,O,O-tris(p-aminophenyl) ester;Tris(4-Amino Phenyl)thiophos;Einecs 258-083-6;2-[2-cyclopentylimino-3-(2-methylphenyl)-4-oxo-5-thiazolidinyl]acetic acid | | CAS: | 52664-35-4 | | MF: | C18H18N3O3PS | | MW: | 387.39 | | EINECS: | 258-083-6 | | Product Categories: | | | Mol File: | 52664-35-4.mol |  |
| | Tris-(4-aminophenyl)thiophosphate Chemical Properties |
| Melting point | 156℃ | | Boiling point | 597.9±60.0 °C(Predicted) | | density | 1.421 | | storage temp. | RT, protect from light | | pka | 4.37±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H18N3O3PS/c19-13-1-7-16(8-2-13)22-25(26,23-17-9-3-14(20)4-10-17)24-18-11-5-15(21)6-12-18/h1-12H,19-21H2 | | InChIKey | MBUAAMOJATXYKR-UHFFFAOYSA-N | | SMILES | P(=S)(OC1C=CC(N)=CC=1)(OC1C=CC(N)=CC=1)OC1C=CC(N)=CC=1 |
| | Tris-(4-aminophenyl)thiophosphate Usage And Synthesis |
| | Tris-(4-aminophenyl)thiophosphate Preparation Products And Raw materials |
|