| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,4',4''-Trichlorotrityl alcohol Basic information |
| Product Name: | 4,4',4''-Trichlorotrityl alcohol | | Synonyms: | TRIS-(4-CHLOROPHENYL) METHANOL;Tris(p-chlorophenyl) carbinol~Tris(p-chlorophenyl)methanol;tris(p-chlorophenyl) carbinol;tris(p-chlorophenyl)methanol;4-Chloro-α,α-bis(4-chlorophenyl)benzenemethanol;Tri(4-chlorophenyl)methanol;OC(c(ccc(c1)Cl)c1)(c(ccc(c2)Cl)c2)c(ccc(c3)Cl)c3;(4-chlorophenyl)-(4,4-dichloro-1-cyclohexa-1,5-dienyl)-phenylmethanol | | CAS: | 3010-80-8 | | MF: | C19H13Cl3O | | MW: | 363.66 | | EINECS: | 221-137-4 | | Product Categories: | | | Mol File: | 3010-80-8.mol |  |
| | 4,4',4''-Trichlorotrityl alcohol Chemical Properties |
| Melting point | 96-97°C | | storage temp. | 2-8°C | | BRN | 2293156 |
| Provider | Language |
|
ALFA
| English |
| | 4,4',4''-Trichlorotrityl alcohol Usage And Synthesis |
| Uses | Tris(4-chlorophenyl)methanol is a standard for environmental testing and research. Study on the effects of environmental poluutants/organochlorines on male fertility. |
| | 4,4',4''-Trichlorotrityl alcohol Preparation Products And Raw materials |
|