- 4-Bromocumene
-
- $100.00
-
2026-09-02
- CAS:586-61-8
- Min. Order: 1KG
- Purity: 99%
- 4-BROMOCUMENE
-
-
2026-07-21
- CAS:586-61-8
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 20tons
- 4-Bromocumene
-
-
2026-06-30
- CAS:586-61-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 4-Bromocumene Basic information |
| | 4-Bromocumene Chemical Properties |
| Melting point | -22 °C | | Boiling point | 103-104 °C(lit.) | | density | 1.286 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.537 | | Fp | >100°C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Water Solubility | Insoluble in water | | BRN | 1858096 | | InChI | InChI=1S/C9H11Br/c1-7(2)8-3-5-9(10)6-4-8/h3-7H,1-2H3 | | InChIKey | MOZHUOIQYVYEPN-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(C(C)C)C=C1 | | CAS DataBase Reference | 586-61-8(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-bromo-4-(1-methylethyl)-(586-61-8) | | EPA Substance Registry System | p-Bromocumene (586-61-8) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 22-51/53 | | Safety Statements | 60 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 2 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HazardClass | 9 | | HS Code | 29039990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2 |
| | 4-Bromocumene Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | It employed as a intermediate for pharmaceutical. |
| | 4-Bromocumene Preparation Products And Raw materials |
|