|
|
| | Tetrakis(2-ethylhexoxy)silane Basic information |
| Product Name: | Tetrakis(2-ethylhexoxy)silane | | Synonyms: | 2-ethyl-1-hexanolsilicate;2-ethyl-1-hexanotetraesterwithsilicicacid;2-ethylhexanoltetrasilicate;TETRA-(2-ETHYLHEXYL) ORTHOSILICATE;TETRA-(2-ETHYLHEXYL) SILICATE;TETRAKIS(2-ETHYLHEXYL)SILICATE;tetrakis(2-ethylhexyl) orthosilicate;Tetrakis(2-ethylhexoyl)silane | | CAS: | 115-82-2 | | MF: | C32H68O4Si | | MW: | 544.97 | | EINECS: | 204-109-6 | | Product Categories: | | | Mol File: | 115-82-2.mol |  |
| | Tetrakis(2-ethylhexoxy)silane Chemical Properties |
| Melting point | <-73°C | | Boiling point | 194 °C | | density | 0.88 | | refractive index | 1.4388 | | Fp | 188°C | | form | liquid | | Specific Gravity | 0.88 | | color | Colorless to Almost colorless | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C32H68O4Si/c1-9-17-21-29(13-5)25-33-37(34-26-30(14-6)22-18-10-2,35-27-31(15-7)23-19-11-3)36-28-32(16-8)24-20-12-4/h29-32H,9-28H2,1-8H3 | | InChIKey | MQHSFMJHURNQIE-UHFFFAOYSA-N | | SMILES | [Si](OCC(CC)CCCC)(OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC | | EPA Substance Registry System | Silicic acid (H4SiO4), tetrakis(2-ethylhexyl) ester (115-82-2) |
| Safety Statements | 23-24/25 | | TSCA | TSCA listed | | HS Code | 2931.90.9010 |
| | Tetrakis(2-ethylhexoxy)silane Usage And Synthesis |
| Chemical Properties | Colorless liquid. Solubility
in water below 0.01, 7.4 lb/gal. Combustible. | | Uses | Synthetic lubricants and functional fluids. |
| | Tetrakis(2-ethylhexoxy)silane Preparation Products And Raw materials |
|