| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,2-Bis(trichlorosilyl)ethane Basic information |
| Product Name: | 1,2-Bis(trichlorosilyl)ethane | | Synonyms: | 1,4-Disilabutane,1,1,1,4,4,4-hexachloro-;Silane, 1,2-ethanediylbis*trichloro-;Silane, 1,2-ethanediylbis[trichloro-;Trichloro[2-(trichlorosilyl)ethyl]silane;1,1,1,4,4,4-HEXACHLORODISILETHYLENE;1,2-ethanediylbis[trichloro-Silane;1,2-Bis(tichlorosilyl)ethane;ethylenebis(trichlorosilane) | | CAS: | 2504-64-5 | | MF: | C2H4Cl6Si2 | | MW: | 296.94 | | EINECS: | 219-710-9 | | Product Categories: | Industrial/Fine Chemicals;Si (Classes of Silicon Compounds);Si-Cl Compounds;Trichlorosilanes | | Mol File: | 2504-64-5.mol |  |
| | 1,2-Bis(trichlorosilyl)ethane Chemical Properties |
| Melting point | 27-29 °C(lit.) | | Boiling point | 202 °C(lit.) | | density | 1.483 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.475(lit.) | | Fp | 149 °F | | storage temp. | 2-8°C | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Specific Gravity | 1.483 | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 1753707 | | InChI | 1S/C2H4Cl6Si2/c3-9(4,5)1-2-10(6,7)8/h1-2H2 | | InChIKey | WDVUXWDZTPZIIE-UHFFFAOYSA-N | | SMILES | Cl[Si](Cl)(Cl)CC[Si](Cl)(Cl)Cl | | CAS DataBase Reference | 2504-64-5(CAS DataBase Reference) | | EPA Substance Registry System | Silane, 1,2-ethanediylbis[trichloro- (2504-64-5) |
| Hazard Codes | C | | Risk Statements | 14-35 | | Safety Statements | 26-36/37/39-43-45 | | RIDADR | UN 3261 8/PG 1 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 1,2-Bis(trichlorosilyl)ethane Usage And Synthesis |
| Chemical Properties | Colorless crystal | | Uses | Intermediate for silicones. | | General Description | 1,2-Bis(trichlorosilyl)ethane is an alkylchlorosilane that couples with surface atoms present on the metal surfaces. It is mainly utilized as a protective coating and a coupling agent that enhances the absorption of the self-assembled monolayer (SAM) on the surface of the metal. It chemically modifies the substrate material and acts as an anti-corrosive layer. | | Hazard | Corrosive when exposed to moisture. |
| | 1,2-Bis(trichlorosilyl)ethane Preparation Products And Raw materials |
|