|
|
| | L-Glutamic-15N acid, N-t-Boc derivative Basic information |
| Product Name: | L-Glutamic-15N acid, N-t-Boc derivative | | Synonyms: | Boc-Glu-OH-15N;L-Glutamic-15N acid, N-t-Boc derviative, N-(tert-Butoxycarbonyl)-L-glutamic acid-15N;"L-Glutamic Acid-15N, N-Boc";Boc-Glu-OH-15N;L-Glutamic-15N acid, N-t-Boc derivative | | CAS: | 287484-35-9 | | MF: | C10H17NO6 | | MW: | 248.25 | | EINECS: | | | Product Categories: | | | Mol File: | 287484-35-9.mol |  |
| | L-Glutamic-15N acid, N-t-Boc derivative Chemical Properties |
| Melting point | 110 °C (dec.)(lit.) | | Major Application | peptide synthesis | | InChI | 1S/C10H17NO6/c1-10(2,3)17-9(16)11-6(8(14)15)4-5-7(12)13/h6H,4-5H2,1-3H3,(H,11,16)(H,12,13)(H,14,15)/t6-/m0/s1/i11+1 | | InChIKey | AQTUACKQXJNHFQ-NTLODJOYSA-N | | SMILES | CC(C)(C)OC(=O)[15NH][C@@H](CCC(O)=O)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Glutamic-15N acid, N-t-Boc derivative Usage And Synthesis |
| | L-Glutamic-15N acid, N-t-Boc derivative Preparation Products And Raw materials |
|