| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | BOC-[15N]ALA-OH Basic information |
| Product Name: | BOC-[15N]ALA-OH | | Synonyms: | BOC-[15N]ALANINE;BOC-[15N]ALA-OH;N-(TERT-BUTOXYCARBONYL)-L-ALANINE-15N;N-ALPHA-BUTOXYCARBONYL-[15N]-L-ALANINE;N-(TERT-BUTOXYCARBONYL)-L-ALANINE-15N, 9 9 ATOM % 15N;n-(tert-butoxycarbonyl)-l-alanine-15n98+atom%15n;boc-ala-oh-15n;N-(tert-Butoxycarbonyl)-L-alanine-15N, L-Alanine-15N, N-t-Boc derivative | | CAS: | 139952-87-7 | | MF: | C8H15NO4 | | MW: | 190.22 | | EINECS: | | | Product Categories: | | | Mol File: | 139952-87-7.mol | ![BOC-[15N]ALA-OH Structure](CAS/GIF/139952-87-7.gif) |
| | BOC-[15N]ALA-OH Chemical Properties |
| Melting point | 79-83 °C (lit.) | | storage temp. | -15°C | | form | solid | | Optical Rotation | [α]20/D 23°, c = 2 in acetic acid | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i9+1 | | InChIKey | QVHJQCGUWFKTSE-LBBOFACRSA-N | | SMILES | C[C@H]([15NH]C(=O)OC(C)(C)C)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BOC-[15N]ALA-OH Usage And Synthesis |
| Uses | L-Alanine-15N-N-t-BOC (CAS# 139952-87-7) is a useful isotopically labeled research compound. This compound can be synthesized from chiral alpha-hydroxy acids. Gradiently enriching this compound also helps provide insights into glycoprotein behavior. |
| | BOC-[15N]ALA-OH Preparation Products And Raw materials |
|