(S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL manufacturers
|
| | (S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL Basic information |
| Product Name: | (S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL | | Synonyms: | (S)-(-)-2-(N-BOC-AMINO)-1,5-PENTANEDIOL;(2S)-2-methylpentane-1,5-diol;tert-butyl(S)-1,5-dihydroxypentan-2-ylcarbamate;(S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL;Carbamic acid, [(1S)-4-hydroxy-1-(hydroxymethyl)butyl]-, 1,1-dimethylethyl;Boc-Nva(OH)-ol;Carbamic acid, N-[(1S)-4-hydroxy-1-(hydroxymethyl)butyl]-, 1,1-dimethylethyl ester;(S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL USP/EP/BP | | CAS: | 162955-48-8 | | MF: | C10H21NO4 | | MW: | 219.28 | | EINECS: | | | Product Categories: | N-BOC;Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 162955-48-8.mol |  |
| | (S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL Chemical Properties |
| Melting point | 59-62 °C (lit.) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 15°, c = 1 in chloroform | | InChI | 1S/C10H21NO4/c1-10(2,3)15-9(14)11-8(7-13)5-4-6-12/h8,12-13H,4-7H2,1-3H3,(H,11,14)/t8-/m0/s1 | | InChIKey | UBNNKNSFDFANKW-QMMMGPOBSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CO)CCCO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL Usage And Synthesis |
| | (S)-(-)-2-(BOC-AMINO)-1,5-PENTANEDIOL Preparation Products And Raw materials |
|