| Company Name: |
Chembest Research Laboratories Limited
|
| Tel: |
021-20908456 |
| Email: |
sales@BioChemBest.com |
| Products Intro: |
Product Name:Sparstolonin B (SsnB)
CAS:1259330-61-4
Purity:98+% Package:10mg;50mg;100mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Sparstolonin B
CAS:1259330-61-4
Purity:>=98% (HPLC) Package:5MG Remarks:SML1767-5MG
|
|
| | Sparstolonin B Basic information |
| Product Name: | Sparstolonin B | | Synonyms: | Sparstolonin B;3H-Pyrano[3,4,5-kl]xanthen-3-one, 4,10-dihydroxy-;Sparstolonin B >=98% (HPLC);Sparstolonin B (SsnB) | | CAS: | 1259330-61-4 | | MF: | C15H8O5 | | MW: | 268.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1259330-61-4.mol |  |
| | Sparstolonin B Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO : 10 mg/mL (Need ultrasonic and warming) | | form | powder | | color | white to beige | | InChI | 1S/C15H8O5/c16-7-1-3-11-8(5-7)9-6-19-15(18)14-10(17)2-4-12(20-11)13(9)14/h1-6,16-17H | | InChIKey | DHSASSJDMAHICE-UHFFFAOYSA-N | | SMILES | OC(C=C1)=CC2=C1OC3=C4C(C(OC=C42)=O)=C(O)C=C3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | Sparstolonin B Usage And Synthesis |
| Uses | Sparstolonin B acts as a selective TLR2 and TLR4 antagonist and selectively blocks TLR2- and TLR4-mediated inflammatory signaling. Sparstolonin B has anti-HIV and anticancer activities[1][2]. | | Biochem/physiol Actions | Sparstolonin B (SsnB) is a polyphenol. It has a structural features similar to xanthone and isocoumarin. SsnB exerts anti-inflammatory properties on mouse and human macrophages. SsnB can significantly reduce hypoxia–reoxygenation-induced inflammation of cardiomyocytes by blocking extracellular signal-regulated protein kinase (ERK1/2) and c-jun N-terminal kinases (JNK) signaling pathways. Thus, SsnB acts as a potent therapeutic for the treatment of myocardial ischemia–reperfusion (MIR) injury. | | in vivo | Sparstolonin B (100 μg/mouse; i.p.) suppresses LPS-provoked inflammation in mice[1]. | Animal Model: | 5-6-week-old male C57Bl/6 mice (body weight 18-20 g)[1] | | Dosage: | 100 μg/mouse | | Administration: | I.p. | | Result: | Significantly lower TNFα and IL-1β expression levels in LPS-induced sepsis mouse model.
|
| | IC 50 | TLR2; TLR4; HIV-1 | | References | [1] Liang Q, et al. Characterization of sparstolonin B, a Chinese herb-derived compound, as a selective Toll-like receptor antagonist with potent anti-inflammatory properties. J Biol Chem. 2011;286(30):26470-26479. DOI:10.1074/jbc.M111.227934
[2] Deng X, et al. The Chinese herb-derived Sparstolonin B suppresses HIV-1 transcription. Virol J. 2015;12:108. Published 2015 Jul 25. DOI:10.1186/s12985-015-0339-8
[3] Kumar A, et al. Sparstolonin B, a novel plant derived compound, arrests cell cycle and induces apoptosis in N-myc amplified and N-myc nonamplified neuroblastoma cells [published correction appears in PLoS One. 2016;11(7):e0159082]. PLoS One. 2014;9(5):e96343. Published 2014 May 1. DOI:10.1371/journal.pone.0096343 |
| | Sparstolonin B Preparation Products And Raw materials |
|