| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3,4-Trifluorobenzenesulfonyl chloride Basic information |
| Product Name: | 2,3,4-Trifluorobenzenesulfonyl chloride | | Synonyms: | BUTTPARK 44\07-12;2,3,4-TRIFLUOROBENZENE-1-SULFONYL CHLORIDE;2,3,4-TRIFLUOROBENZENESULPHONYL CHLORIDE;Benzenesulfonyl chloride, 2,3,4-trifluoro- (9CI);2,3,4-Trifluorobenz;2,3,4-Trifluorobenzenesulphonyl chloride 97%;2,3,4-Trifluorobenzenesulphonylchloride97%;2,3,4-Trifluorobenzenesulfonyl chloride 97% | | CAS: | 175278-08-7 | | MF: | C6H2ClF3O2S | | MW: | 230.59 | | EINECS: | | | Product Categories: | Aromatic Halides (substituted);Benzenesulfonyl chloride;Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds;Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds;SULFONYLHALIDE;C6 | | Mol File: | 175278-08-7.mol |  |
| | 2,3,4-Trifluorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 122-124 °C | | Boiling point | 234-236 °C(lit.) | | density | 1.640 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5040(lit.) | | Fp | 225 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | color | Clear, faint yellow | | Sensitive | Moisture Sensitive | | InChI | 1S/C6H2ClF3O2S/c7-13(11,12)4-2-1-3(8)5(9)6(4)10/h1-2H | | InChIKey | XFTDZYFHXRZLEF-UHFFFAOYSA-N | | SMILES | Fc1ccc(c(F)c1F)S(Cl)(=O)=O | | CAS DataBase Reference | 175278-08-7(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-39-37-36 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2,3,4-Trifluorobenzenesulfonyl chloride Usage And Synthesis |
| Uses | 2,3,4-Trifluorobenzenesulfonyl chloride may be used as an arylating agent during the synthesis of (2,3,4-trifluorophenyl)furan derivatives. It may also be employed during the preparation of 1-(2-bromobenzyl)-2,5-bis(2,3,4-trifluorophenyl)pyrrole and 1-(2-bromobenzyl)-2-(2,3,4-trifluorophenyl)pyrrole. | | General Description | 2,3,4-Trifluorobenzenesulfonyl chloride may be used as an arylating agent during the synthesis of (2,3,4-trifluorophenyl)furan derivatives. It may also be employed during the preparation of 1-(2-bromobenzyl)-2,5-bis(2,3,4-trifluorophenyl)pyrrole and 1-(2-bromobenzyl)-2-(2,3,4-trifluorophenyl)pyrrole. |
| | 2,3,4-Trifluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|