2-Phenylquinolin-4-ol manufacturers
|
| | 2-Phenylquinolin-4-ol Basic information |
| Product Name: | 2-Phenylquinolin-4-ol | | Synonyms: | 2-PHENYLQUINOLIN-4-OL;4-Hydroxy-2-phenylquinoline;2-Phenyl-4-quinolinol;4-Quinolinol, 2-phenyl- | | CAS: | 1144-20-3 | | MF: | C15H11NO | | MW: | 221.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1144-20-3.mol |  |
| | 2-Phenylquinolin-4-ol Chemical Properties |
| Melting point | 253 °C | | Boiling point | 434.0±33.0 °C(Predicted) | | density | 1.225±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.18±0.40(Predicted) | | color | Off White to Pale Beige | | InChI | 1S/C15H11NO/c17-15-10-14(11-6-2-1-3-7-11)16-13-9-5-4-8-12(13)15/h1-10H,(H,16,17) | | InChIKey | JGABMVVOXLQCKZ-UHFFFAOYSA-N | | SMILES | OC1=CC(C2=CC=CC=C2)=NC3=C1C=CC=C3 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 2-Phenylquinolin-4-ol Usage And Synthesis |
| Uses | 4-Hydroxy-2-phenylquinoline (cas# 1144-20-3) is a useful bacterial efflux pump inhibitor. | | Synthesis Reference(s) | Journal of the American Chemical Society, 68, p. 1270, 1946 DOI: 10.1021/ja01211a041 |
| | 2-Phenylquinolin-4-ol Preparation Products And Raw materials |
|