|
|
| | 2-METHYL-5-NITROINDOLE Basic information |
| | 2-METHYL-5-NITROINDOLE Chemical Properties |
| Melting point | 172-176 °C (lit.) | | Boiling point | 307.77°C (rough estimate) | | density | 1.2662 (rough estimate) | | refractive index | 1.5570 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 15.82±0.30(Predicted) | | form | Crystalline Powder | | color | Yellow to orange-brown | | InChI | 1S/C9H8N2O2/c1-6-4-7-5-8(11(12)13)2-3-9(7)10-6/h2-5,10H,1H3 | | InChIKey | IDJGRXQMAHESOD-UHFFFAOYSA-N | | SMILES | Cc1cc2cc(ccc2[nH]1)[N+]([O-])=O | | CAS DataBase Reference | 7570-47-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-METHYL-5-NITROINDOLE Usage And Synthesis |
| Chemical Properties | yellow to orange-brown crystalline powder | | Uses | Reactant for preparation of:β
- Cyanoindoles
- Methanoindoles
- Protein kinase C theta (PKCθ) inhibitors
- Tubulin polymerization inhibitors
- Peptide-mimetic protease-activated receptor-1 (PAR-1) antagonists
- Cytosolic phospholipase A2α
- Cyclooxygenase (COX) inhibitors
- Serotonin 5-HT6 Receptor Ligands
- Heterocyclic β-substituted alanine derivatives
|
| | 2-METHYL-5-NITROINDOLE Preparation Products And Raw materials |
|