| Company Name: |
Aoxuan Biological Technology Co., Ltd.
|
| Tel: |
17073140108 |
| Email: |
|
| Products Intro: |
Product Name:cppp CAS:100828-16-8 Purity:99.8% Package:1kg/Aluminum foil bag;25kg/drum;100USD/1-10gram Remarks:cherry@hebeiaoxuan.com SKYPE ID:sophia86826
|
|
| | (+/-)-3-(2-CARBOXYPIPERAZIN-4-YL)-PROPYL-1-PHOSPHONIC ACID Basic information |
| | (+/-)-3-(2-CARBOXYPIPERAZIN-4-YL)-PROPYL-1-PHOSPHONIC ACID Chemical Properties |
| Boiling point | 546.7±60.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | Desiccate at RT | | solubility | H2O: 99.2 mg/mL | | form | solid | | pka | 1.89±0.20(Predicted) | | color | white | | Water Solubility | Soluble to 100 mM in water | | InChI | 1S/C8H17N2O5P/c11-8(12)7-6-10(4-2-9-7)3-1-5-16(13,14)15/h7,9H,1-6H2,(H,11,12)(H2,13,14,15) | | InChIKey | CUVGUPIVTLGRGI-UHFFFAOYSA-N | | SMILES | OC(=O)C1CN(CCCP(O)(O)=O)CCN1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+/-)-3-(2-CARBOXYPIPERAZIN-4-YL)-PROPYL-1-PHOSPHONIC ACID Usage And Synthesis |
| Uses | (+)-3-(2-Carboxypiperazin-4-yl)-propyl-1-phosphoric Acid is a compound with NMDA antagonistic activity. | | Synthesis Reference(s) | Tetrahedron Letters, 30, p. 5193, 1989 DOI: 10.1016/S0040-4039(01)93739-6 | | Biological Activity | Potent NMDA antagonist. See separate isomer (3-((R)-2-Carboxypiperazin-4-yl)-propyl-1-phosphonicacid ). | | Biochem/physiol Actions | Potent and selective NMDA glutamate receptor antagonist; anticonvulsant. | | storage | Room temperature (desiccate) |
| | (+/-)-3-(2-CARBOXYPIPERAZIN-4-YL)-PROPYL-1-PHOSPHONIC ACID Preparation Products And Raw materials |
|