|
|
| | 2,5-DI-TERT-BUTYLPHENOL Basic information |
| Product Name: | 2,5-DI-TERT-BUTYLPHENOL | | Synonyms: | 2,5-DI-TERT-BUTYLPHENOL;2,5-bis(1,1-dimethylethyl)-pheno;2,5-bis(1,1-dimethylethyl)-Phenol;Phenol, 2,5-di-tert-butyl-;DI-TERT-BUTYLPHENOL;Phenol, 2,5-bis(1,1-dimethylethyl;Einecs 227-543-8;Nsc 68767 | | CAS: | 5875-45-6 | | MF: | C14H22O | | MW: | 206.32 | | EINECS: | 227-543-8 | | Product Categories: | | | Mol File: | 5875-45-6.mol |  |
| | 2,5-DI-TERT-BUTYLPHENOL Chemical Properties |
| Melting point | 141.1-142.2 °C | | Boiling point | 283.4±9.0 °C(Predicted) | | density | 0.932±0.06 g/cm3(Predicted) | | pka | 11.46±0.10(Predicted) | | InChI | InChI=1S/C14H22O/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9,15H,1-6H3 | | InChIKey | KDBZVULQVCUNNA-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C(C)(C)C)=CC=C1C(C)(C)C | | EPA Substance Registry System | Phenol, 2,5-bis(1,1-dimethylethyl)- (5875-45-6) |
| RIDADR | 3077 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III |
| | 2,5-DI-TERT-BUTYLPHENOL Usage And Synthesis |
| Definition | ChEBI: 2,5-di-tert-butylphenol is a member of the class of phenols that is phenol substituted by tert-butyl groups at position 2 and 5. It has a role as a plant metabolite and a mammalian metabolite. It is a member of phenols and an alkylbenzene. |
| | 2,5-DI-TERT-BUTYLPHENOL Preparation Products And Raw materials |
|