| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Nitrobenzene (13C6) Basic information |
| | Nitrobenzene (13C6) Chemical Properties |
| Melting point | 5-6 °C(lit.) | | Boiling point | 210-211 °C (lit.) | | density | 1.253 g/mL at 25 °C | | refractive index | n20/D 1.553(lit.) | | Fp | 88 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | LQNUZADURLCDLV-IDEBNGHGSA-N | | SMILES | [O-][N+](=O)[13c]1[13cH][13cH][13cH][13cH][13cH]1 | | CAS Number Unlabeled | 98-95-3 |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-40-48/23/24-51/53-62-52/53-48/23/24/25-60 | | Safety Statements | 28-36/37-45-61-53 | | RIDADR | UN 1662 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 3
Carc. 2
Repr. 1B
STOT RE 1 Inhalation |
| | Nitrobenzene (13C6) Usage And Synthesis |
| Uses | Isotope labelled Nitrobenzene (N493000), used mainly in the production of the chemical precursor aniline as well as in azobenzene synthesis (1). Also may be reduced through magnetic iron oxide nanocrystals (2). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants. |
| | Nitrobenzene (13C6) Preparation Products And Raw materials |
|