|
|
| | 1,3-Dinitrobenzene (13C6) Basic information |
| Product Name: | 1,3-Dinitrobenzene (13C6) | | Synonyms: | 1,3-DINITROBENZENE-13C6, 99 ATOM % 13C;1,3-dinitro(1,2,3,4,5,6-^{13}C_{6})cyclohexa-1,3,5-triene;1,3-DINITROBENZENE (13C6, 99%) 1 MG/ML IN ACETONITRILE;13C6]-1,3-Dinitrobenzene;1,3-Dinitrobenzene-13C?;1,3-Dinitrobenzene-13C6;1,3-Dinitrobenzene (13C?, 99%);1,3-Dinitrobenzene (13C?, 99%) 1 mg/mL in acetonitrile | | CAS: | 201595-60-0 | | MF: | C6H4N2O4 | | MW: | 174.16 | | EINECS: | | | Product Categories: | Alphabetical Listings;D;Stable Isotopes | | Mol File: | 201595-60-0.mol |  |
| | 1,3-Dinitrobenzene (13C6) Chemical Properties |
| Melting point | 88-90 °C (lit.) | | Boiling point | 297 °C (lit.) | | density | 1.416 g/mL at 25 °C | | Fp | 150℃ | | solubility | soluble in Dichloromethane | | form | Solid | | color | Off-white | | InChI | 1S/C6H4N2O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | WDCYWAQPCXBPJA-IDEBNGHGSA-N | | SMILES | [O-][N+](=O)[13c]1[13cH][13cH][13cH][13c]([13cH]1)[N+]([O-])=O | | CAS Number Unlabeled | 99-65-0 |
| Hazard Codes | T+ | | Risk Statements | 5-26/27/28-33-40 | | Safety Statements | 22-36/37/39-45 | | RIDADR | UN 3443 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 2 Inhalation
Acute Tox. 2 Oral
Aquatic Acute 1
Aquatic Chronic 1
STOT RE 2 |
| | 1,3-Dinitrobenzene (13C6) Usage And Synthesis |
| Uses | 1,3-Dinitrobenzene-13C6 is an intermediate in the synthesis of Hexachlorobenzene-13C6 (H290817). Hexachlorobenzene-13C6 , is the labeled analogue of Hexachlorobenzene, which is a fungicide formerly used as a seed treatment, especially on wheat to control the fungal disease bunt. |
| | 1,3-Dinitrobenzene (13C6) Preparation Products And Raw materials |
|