|
|
| | 4,6-Diaminoresorcinol Basic information |
| Product Name: | 4,6-Diaminoresorcinol | | Synonyms: | 4,6-DIAMINORESORCINOL;4,6-Diaminoresorcinol dihydrochlorid;4,6-DIAMINORESORCINOL 2HCL;DIAMINO RESORCINOL;4,6-Diamino-1,3-benzenediol;4,6-Diaminoresorcino;1,3-Benzenediol, 4,6-diaMino-;4,6-Diaminoresorcinol (DAR) | | CAS: | 15791-87-4 | | MF: | C6H8N2O2 | | MW: | 140.14 | | EINECS: | | | Product Categories: | | | Mol File: | 15791-87-4.mol |  |
| | 4,6-Diaminoresorcinol Chemical Properties |
| Boiling point | 430.1±25.0 °C(Predicted) | | density | 1.542 | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | 9.52±0.23(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H8N2O2/c7-3-1-4(8)6(10)2-5(3)9/h1-2,9-10H,7-8H2 | | InChIKey | DPYROBMRMXHROQ-UHFFFAOYSA-N | | SMILES | C1(O)=C(N)C=C(N)C(O)=C1 | | CAS DataBase Reference | 15791-87-4(CAS DataBase Reference) |
| | 4,6-Diaminoresorcinol Usage And Synthesis |
| | 4,6-Diaminoresorcinol Preparation Products And Raw materials |
|