|
|
| | FAMPHUR Basic information |
| Product Name: | FAMPHUR | | Synonyms: | BO-ANA;FAMOPHOS(R);FAMPHUR;O,O-DIMETHYL-O-P-(DIMETHYLSULFAMOYL)PHENYL PHOSPHOROTHIOATE;WARBEXOL;WARBEX(R);AC 38023;ac38023 | | CAS: | 52-85-7 | | MF: | C10H16NO5PS2 | | MW: | 325.34 | | EINECS: | 200-154-0 | | Product Categories: | | | Mol File: | 52-85-7.mol |  |
| | FAMPHUR Chemical Properties |
| Melting point | 53℃ | | Boiling point | 394.2±52.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | vapor pressure | 3 x 10-5 Pa (est. 20 °C) | | Fp | >100 °C | | storage temp. | APPROX 4°C | | form | Liquid | | pka | -5.18±0.70(Predicted) | | Water Solubility | 5000 (est. 20 °C) | | Merck | 13,3963 | | BRN | 2224254 | | InChI | 1S/C10H16NO5PS2/c1-11(2)19(12,13)10-7-5-9(6-8-10)16-17(18,14-3)15-4/h5-8H,1-4H3 | | InChIKey | JISACBWYRJHSMG-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)Oc1ccc(cc1)S(=O)(=O)N(C)C | | EPA Substance Registry System | Famphur (52-85-7) |
| | FAMPHUR Usage And Synthesis |
| Chemical Properties | Crystalline powder. Very soluble in chloroform and carbon tetrachloride; slightly
soluble in water. | | Uses | Insecticide. | | Definition | ChEBI: Famphur is an organic thiophosphate and an organothiophosphate insecticide. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an agrochemical and an anthelminthic drug. It is functionally related to a 4-hydroxy-N,N-dimethylbenzenesulfonamide. | | General Description | Crystalline powder. Very toxic. Cholinesterase inhibitor. Restricted use as insecticide. | | Air & Water Reactions | Slightly soluble in water. | | Reactivity Profile | Organothiophosphates, such as FAMPHUR, are susceptible to formation of highly toxic and flammable phosphine gas in the presence of strong reducing agents such as hydrides. Partial oxidation by oxidizing agents may result in the release of toxic phosphorus oxides. | | Hazard | Cholinesterase inhibitor, use may be
restricted. | | Metabolism | The principal degradation routes in mammals are POphenyl
bond cleavage and O-demethylation. Oxidative
desulfuration and N-demethylation also take place to form
toxic metabolites. | | Toxicity evaluation | The acute oral LD50 for rats is 35–62 mg/kg. |
| | FAMPHUR Preparation Products And Raw materials |
|