| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4,4'-DIMETHYLBIPHENYL manufacturers
|
| | 4,4'-DIMETHYLBIPHENYL Basic information |
| Product Name: | 4,4'-DIMETHYLBIPHENYL | | Synonyms: | TIMTEC-BB SBB008499;4,4'-BITOLUENE;4,4'-BITOLYL;4,4'-DIMETHYLDIPHENYL;P,P'-BITOLYL;3,4-dimethylbenzenesulfonyl chloride(SALTDATA: FREE);3,4-Xylenesulfonyl chloride;4-(Chlorosulfonyl)-1,2-dimethylbenzene | | CAS: | 2905-30-8 | | MF: | C8H9ClO2S | | MW: | 204.67 | | EINECS: | 210-337-7 | | Product Categories: | | | Mol File: | 2905-30-8.mol |  |
| | 4,4'-DIMETHYLBIPHENYL Chemical Properties |
| Melting point | 118-120 °C(lit.) | | Boiling point | 295 °C(lit.) | | density | 1.290 | | storage temp. | 2-8°C | | Appearance | Off-white to light brown Solid | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C8H9ClO2S/c1-6-3-4-8(5-7(6)2)12(9,10)11/h3-5H,1-2H3 | | InChIKey | DNMQPRPJIWTNAX-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=C(C)C(C)=C1 | | CAS DataBase Reference | 2905-30-8(CAS DataBase Reference) |
| Risk Statements | 34 | | Safety Statements | 24/25 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II |
| | 4,4'-DIMETHYLBIPHENYL Usage And Synthesis |
| Uses | 3,4-Dimethylbenzenesulfonyl chloride is used as an intermediate. |
| | 4,4'-DIMETHYLBIPHENYL Preparation Products And Raw materials |
|