| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- D-Ala-Otbu.Hcl
-
-
2026-09-15
- CAS:59531-86-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | D-Alanine tert-butyl ester hydrochloride Basic information |
| | D-Alanine tert-butyl ester hydrochloride Chemical Properties |
| Melting point | 170-175 °C | | alpha | -1.4 º (c=2%, EtOH) | | refractive index | -1.4 ° (C=2, EtOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Soluble in water | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 1.4±0.3°, c = 2% in ethanol | | Sensitive | Hygroscopic | | BRN | 5763077 | | Major Application | peptide synthesis | | InChI | 1S/C7H15NO2.ClH/c1-5(8)6(9)10-7(2,3)4;/h5H,8H2,1-4H3;1H/t5-;/m1./s1 | | InChIKey | WIQIWPPQGWGVHD-NUBCRITNSA-N | | SMILES | Cl.C[C@@H](N)C(=O)OC(C)(C)C | | CAS DataBase Reference | 59531-86-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 13 - Non Combustible Solids |
| | D-Alanine tert-butyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | White powder | | Uses | D-Alanine tert-butyl ester is a protected form of D-Alanine (A480995). D-Alanine is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | D-Alanine tert-butyl ester hydrochloride Preparation Products And Raw materials |
|