|
|
| | 4,7-DIHYDROXY-1,10-PHENANTHROLINE Basic information |
| Product Name: | 4,7-DIHYDROXY-1,10-PHENANTHROLINE | | Synonyms: | 4,7-DIHYDROXY-1,10-PHENANTHROLINE;TIMTEC-BB SBB008750;4,7-dihydroxy-1,10-phenanthroline (dye content ca;4,7-DIHYDROXY-1,10-PHENANTHROLINE (DYE C ONTENT CA. 30%);4 7-DIHYDROXY-1,10-PHENANTHROLINE ACS;1,10-dihydro-1,10-phenanthroline-4,7-dione;1,10-dihydro-1,10-phenanthroline-4,7-quinone;4,7-Dihydroxy-1,10-phenanthrolin | | CAS: | 3922-40-5 | | MF: | C12H8N2O2 | | MW: | 212.2 | | EINECS: | 223-493-6 | | Product Categories: | | | Mol File: | 3922-40-5.mol |  |
| | 4,7-DIHYDROXY-1,10-PHENANTHROLINE Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | Boiling point | 515.8±45.0 °C(Predicted) | | density | 1.505±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 3.81±0.30(Predicted) | | form | Powder | | color | Yellow | | Water Solubility | Insoluble in water. | | Sensitive | Hygroscopic | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C12H8N2O2/c15-9-3-5-13-11-7(9)1-2-8-10(16)4-6-14-12(8)11/h1-6H,(H,13,15)(H,14,16) | | InChIKey | SLIBCJURSADKPV-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC=C3O)C(O)=CC=1 | | EPA Substance Registry System | 1,10-Phenanthroline-4,7-diol (3922-40-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,7-DIHYDROXY-1,10-PHENANTHROLINE Usage And Synthesis |
| Uses | 4,7-Dihydroxy-1,10-phenanthroline is used as a phenanthroline stain. Its iron(II) complex reacts rapidly with dissolved oxygen in aqueous solution, thereby it is utilized for the spectrophotometric determination of dissolved oxygen up to 20 ppm. |
| | 4,7-DIHYDROXY-1,10-PHENANTHROLINE Preparation Products And Raw materials |
|