| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- D-Alloisoleucine
-
- $60.00
-
2026-08-25
- CAS:1509-35-9
- Min. Order: 1KG
- Purity: 0.98
- Supply Ability: 20 tons
- D-allo-Isoleucine
-
- $980.00
-
2025-06-01
- CAS:1509-35-9
- Min. Order: 1g
- Purity: 99 %
- Supply Ability: 5000 Kg
- D-Alloisoleucine
-
- $1.00
-
2019-07-06
- CAS:1509-35-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | D-Alloisoleucine Basic information |
| Product Name: | D-Alloisoleucine | | Synonyms: | D-ALLO-A-AMINO-B-METHYLVALERIC ACID;D-ALLO-2-AMINO-3-METHYLPENTANOIC ACID;D-ALLOISOLEUCINE;d-alloisoleucin;(2R,3S)-2-AMINO-3-METHYLPENTANOIC ACID;Alloisoleucine, D-;threo-d-isoleucine;D-allo-Isoleucine,99% | | CAS: | 1509-35-9 | | MF: | C6H13NO2 | | MW: | 131.17 | | EINECS: | 216-143-9 | | Product Categories: | Isoleucine [Ile, I];Amino Acids | | Mol File: | 1509-35-9.mol |  |
| | D-Alloisoleucine Chemical Properties |
| Melting point | 291 °C (dec.)(lit.) | | alpha | -38 º (in 6N HCl) | | Boiling point | 225.8±23.0 °C(Predicted) | | density | 1.1720 (estimate) | | refractive index | -37 ° (C=4, 6mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Water (Slightly) | | pka | 2.57±0.24(Predicted) | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]20/D 38° in 6 M HCl | | BRN | 1721794 | | Major Application | peptide synthesis | | InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m0/s1 | | InChIKey | AGPKZVBTJJNPAG-CRCLSJGQSA-N | | SMILES | C(O)(=O)[C@@H]([C@@H](C)CC)N | | CAS DataBase Reference | 1509-35-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | RTECS | BA2930000 | | HS Code | 29224999 | | Storage Class | 13 - Non Combustible Solids |
| | D-Alloisoleucine Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | D-allo-Isoleucine is used in the synthesis of a conjugate of epi-jasmonic acid and various antimicrobial peptides. | | Definition | ChEBI: D-alloisoleucine is an alloisoleucine and a D-alpha-amino acid. It is an enantiomer of a L-alloisoleucine. It is a tautomer of a D-alloisoleucine zwitterion. |
| | D-Alloisoleucine Preparation Products And Raw materials |
|