DL-allo-Isoleucine manufacturers
- DL-ALLO-ISOLEUCINE
-
- $1.00
-
2024-08-11
- CAS:3107-04-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | DL-allo-Isoleucine Basic information |
| Product Name: | DL-allo-Isoleucine | | Synonyms: | (2,3)-2-AMINO-3-METHYLPENTANOIC ACID;H-DL-ALLO-ILE-OH;(2RS,3SR)-2-AMINO-3-METHYLPENTANOIC ACID;H-DL-allo-lle-OH;(2RS,3SR)-2-Amino-3-methylpentanoic acid, DL-Alloisoleucine;(2S,3R)-2-amino-3-methyl-valeric acid;(2S,3R)-2-azanyl-3-methyl-pentanoic acid;DL-allo-Isoleucine >=99.0% | | CAS: | 3107-04-8 | | MF: | C6H13NO2 | | MW: | 131.17 | | EINECS: | 221-464-2 | | Product Categories: | Amino Acids | | Mol File: | 3107-04-8.mol |  |
| | DL-allo-Isoleucine Chemical Properties |
| Melting point | ~285 °C (dec.) | | Boiling point | 225.772±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.036±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at RT. | | pka | 2.572±0.24(predicted) | | form | powder | | color | white | | BRN | 1721795 | | Major Application | detection
peptide synthesis | | InChI | 1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m0/s1 | | InChIKey | AGPKZVBTJJNPAG-CRCLSJGQSA-N | | SMILES | CC[C@H](C)[C@@H](N)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-allo-Isoleucine Usage And Synthesis |
| Uses | DL-allo-Isoleucine is used in the preparation of chiral pyrrolidone derivatives and their application as herbicides. | | Definition | ChEBI: D-alloisoleucine is an alloisoleucine and a D-alpha-amino acid. It is an enantiomer of a L-alloisoleucine. It is a tautomer of a D-alloisoleucine zwitterion. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | DL-allo-Isoleucine Preparation Products And Raw materials |
|