| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Difluoromethoxy-3-methoxy-benzaldehyde Basic information |
| | 4-Difluoromethoxy-3-methoxy-benzaldehyde Chemical Properties |
| Boiling point | 105-106°C 1mm | | density | 1.260±0.06 g/cm3(Predicted) | | refractive index | 1.5155 | | storage temp. | Inert atmosphere,2-8°C | | form | liquid | | color | Clear, light orange | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H8F2O3/c1-13-8-4-6(5-12)2-3-7(8)14-9(10)11/h2-5,9H,1H3 | | InChIKey | KGPOVKAYCXTCQS-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OC(F)F)C(OC)=C1 | | CAS DataBase Reference | 162401-70-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | HazardClass | IRRITANT | | HS Code | 2913000090 |
| | 4-Difluoromethoxy-3-methoxy-benzaldehyde Usage And Synthesis |
| Synthesis | 1. DMF (450 mL), vanillin (30.0 g, 0.2 mol) and sodium hydroxide (13.0 g, 0.325 mol) were added to a reaction flask.
2. The reaction system was warmed to 90 °C with continuous stirring for 2 hours.
3. Monochlorodifluoromethane gas was introduced into the reaction system and the reaction progress was monitored by TLC until the vanillin was completely consumed.
4. Upon completion of the reaction, the heating was stopped and the reaction system was cooled to room temperature.
5. The reaction was quenched by addition of water (450 mL) and the reaction mixture was extracted with dichloromethane.
6. The organic phase was washed sequentially with saturated sodium carbonate solution and saturated brine, then dried over anhydrous sodium sulfate.
7. Concentrate the organic phase under pressure to obtain a light yellow oil 3-methoxy-4-(difluoromethoxy)benzaldehyde (31.9 g, 80% yield, 99.2% purity, HPLC chromatogram in Fig. 1), which can be used in subsequent steps without further purification. | | References | [1] Chinese Chemical Letters, 2013, vol. 24, # 8, p. 727 - 730
[2] Patent: CN106883118, 2017, A. Location in patent: Paragraph 0038-0042 |
| | 4-Difluoromethoxy-3-methoxy-benzaldehyde Preparation Products And Raw materials |
|