| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
D(+)-Histidinol dihydrochloride manufacturers
|
| | D(+)-Histidinol dihydrochloride Basic information |
| | D(+)-Histidinol dihydrochloride Chemical Properties |
| Melting point | 193-195 °C(lit.) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +3°, c = 1 in H2O | | Major Application | peptide synthesis | | InChI | 1S/C6H11N3O.2ClH/c7-5(3-10)1-6-2-8-4-9-6;;/h2,4-5,10H,1,3,7H2,(H,8,9);2*1H/t5-;;/m1../s1 | | InChIKey | FRCAFNBBXRWXQA-ZJIMSODOSA-N | | SMILES | Cl.Cl.N[C@@H](CO)Cc1c[nH]cn1 |
| Provider | Language |
|
ACROS
| English |
| | D(+)-Histidinol dihydrochloride Usage And Synthesis |
| Chemical Properties | white to beige crystalline powder or chunks | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | D(+)-Histidinol dihydrochloride Preparation Products And Raw materials |
|