| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
6-Azido-6-deoxy-D-galactose manufacturers
|
| | 6-Azido-6-deoxy-D-galactose Basic information |
| | 6-Azido-6-deoxy-D-galactose Chemical Properties |
| Melting point | 128-130 °C | | storage temp. | 2-8°C | | form | powder | | pka | 12.441±0.20(predicted) | | color | Light yellow to yellow | | Optical Rotation | [α]/D +59.0±3.0°, c = 0.2 in H2O | | BRN | 4906473 | | InChI | 1S/C6H11N3O5/c7-9-8-1-2-3(10)4(11)5(12)6(13)14-2/h2-6,10-13H,1H2/t2-,3-,4+,5-,6/m1/s1 | | InChIKey | CMLRUUHRGSJVMD-GASJEMHNSA-N | | SMILES | OC1O[C@H](CN=[N+]=[N-])[C@@H](O)[C@H](O)[C@H]1O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2940000080 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-Azido-6-deoxy-D-galactose Usage And Synthesis |
| Uses | 6-Azido-6-deoxy-D-galactose is a new selective metabolic chemical reporter (MCR) for labeling O-GlcNAc-modified proteins in cells. | | reaction suitability | reaction type: click chemistry |
| | 6-Azido-6-deoxy-D-galactose Preparation Products And Raw materials |
|