|
|
| | 3-Aminophenylboronic acid monohydrate Basic information |
| | 3-Aminophenylboronic acid monohydrate Chemical Properties |
| Melting point | 94 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in DMSO and methanol. | | form | Crystalline Powder or Crystals | | color | Beige to brown | | Sensitive | Hygroscopic | | BRN | 2936342 | | InChI | InChI=1S/C6H8BNO2.H2O/c8-6-3-1-2-5(4-6)7(9)10;/h1-4,9-10H,8H2;1H2 | | InChIKey | XAEOVQODHLLNKX-UHFFFAOYSA-N | | SMILES | B(C1C=CC=C(N)C=1)(O)O.O | | CAS DataBase Reference | 206658-89-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 3-10 | | Hazard Note | Irritant/Hygroscopic | | HazardClass | IRRITANT, HYGROSCOPIC | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Aminophenylboronic acid monohydrate Usage And Synthesis |
| Chemical Properties | beige to brown crystalline powder or crystals | | Uses | 3-Aminophenylboronic acid monohydrate can be used in suzuki reaction. | | Uses | 3-Aminophenylboronic acid monohydrate is a amino substituted aryl boronic acid used as a base for developing amphiphilic, random glycopolymers, which self-assemble to form nanoparticles (NPs) with potential as a glucose-sensitive agent. 3-Aminophenylboronic Acid is also used as a reagent in the preparation of nonbenzodiazepine hypnotic agents. | | Uses | It is employed as a reagent in the preparation of Suzuki-Miyaura cross-coupling, used for Gram-positive ant virulence drugs and inhibitors of Streptococcus agalactiae Stk1, regioisomer of Zaleplon (a sedative), amphiphilic random glycopolymer, which self-assemble to form nanoparticles, with potential as a glucose-sensitive matrix, chemomechanical polymer that expands and contracts in blood plasma with high glucose selectivity. Aminophenylboronic Acid is also used as a reagent in the preparation of nonbenzodiazepine hypnotic agents. |
| | 3-Aminophenylboronic acid monohydrate Preparation Products And Raw materials |
|