| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol Basic information |
| Product Name: | 3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol | | Synonyms: | 3-(4'-bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthol;3-(4′-brome-4-biphenyl-4-yl)-1,2,3,4-tetrahydro-1-naphthanol;3-(4'-Bromo-4-biphenyl-4-yl)-1,2,3,4-tetenol;1-Naphthalenol, 3-(4'-bromo(1,1'-biphenyl)-4-yl)-1,2,3,4-tetrahydro-;Einecs 260-038-0;3-[4-(4-broMophenyl)phenyl]-1,2,3,4-tetrahydronaphthalen-1-ol;3-(4''-BROMO[1,1''-BIPHENYL]-4-YL)-1,2,3,4-TETRAHYDRO-1-NAPHTHALENOL;Oxyphyllenodiol B | | CAS: | 56181-82-9 | | MF: | C22H19BrO | | MW: | 379.29 | | EINECS: | 260-038-0 | | Product Categories: | | | Mol File: | 56181-82-9.mol | ![3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol Structure](CAS/GIF/56181-82-9.gif) |
| | 3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol Chemical Properties |
| Melting point | 155-157°C | | Boiling point | 512.8±50.0 °C(Predicted) | | density | 1.359±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 14.15±0.40(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C22H19BrO/c23-20-11-9-16(10-12-20)15-5-7-17(8-6-15)19-13-18-3-1-2-4-21(18)22(24)14-19/h1-12,19,22,24H,13-14H2 | | InChIKey | LGYMGAWTNGCUFA-UHFFFAOYSA-N | | SMILES | C1(O)C2=C(C=CC=C2)CC(C2=CC=C(C3=CC=C(Br)C=C3)C=C2)C1 | | EPA Substance Registry System | 1-Naphthalenol, 3-(4'-bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro- (56181-82-9) |
| | 3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol Usage And Synthesis |
| Chemical Properties | This product is white crystals, mp145~147℃, insoluble in water, soluble in dichloroethane, acetic acid and other solvents. | | Uses | 3-(4''-Bromo[1,1''-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol is used to prepare 4-hydroxycoumarin derivatives with antitumor activities. It is also used to synthesize diphenacoum and brodifacoum (B677900) as the rodenticides. |
| | 3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol Preparation Products And Raw materials |
|