|
|
| | UVARIGRANOL B Basic information |
| Product Name: | UVARIGRANOL B | | Synonyms: | UVARIGRANOL B;(1S,2R,3S,4R)-2-[(Benzoyloxy)methyl]-5-cyclohexene-1,2,3,4-tetrol 3-acetate 4-benzoate;5-Cyclohexene-1,2,3,4-tetrol, 2-[(benzoyloxy)methyl]-, 3-acetate 4-benzoate, (1S,2R,3S,4R)- | | CAS: | 164204-79-9 | | MF: | C23H22O8 | | MW: | 426.42 | | EINECS: | | | Product Categories: | | | Mol File: | 164204-79-9.mol |  |
| | UVARIGRANOL B Chemical Properties |
| density | 1.37±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | InChIKey | WTFRADBWXYQLMA-QTDGGUCWSA-N | | SMILES | [C@H]1(O)C=C[C@@H](OC(=O)C2=CC=CC=C2)[C@H](OC(=O)C)[C@]1(COC(=O)C1=CC=CC=C1)O |
| | UVARIGRANOL B Usage And Synthesis |
| Uses | Uvarigranol B, a polyoxygenated cyclohexene, is obtained from the roots of Uvaria grandiflora Roxb (Annonaceae)[1]. | | References | [1] Pan XP, et al. [The structural elucidation of new polyoxygenated cyclohexenes from Uvaria grandiflora]. Yao Xue Xue Bao. 1997 Jul;32(7):530-5. PMID:11596279 |
| | UVARIGRANOL B Preparation Products And Raw materials |
|