|
|
| | N-PHENYL-4-BIPHENYLAMINE Basic information |
| Product Name: | N-PHENYL-4-BIPHENYLAMINE | | Synonyms: | 4-ANILINOBIPHENYL;N-PHENYL-4-BIPHENYLAMINE;N-Phenyl-biphenyl-4-aMine;N-(4-Biphenylyl)-N-phenylamine;4-(Phenylamino)-1,1'-biphenyl;4-Phenyldiphenylamine;Biphenyl-4-ylphenylamine;N-(1,1'-Biphenyl-4-yl)-N-phenylamine | | CAS: | 32228-99-2 | | MF: | C18H15N | | MW: | 245.32 | | EINECS: | 202-303-5 | | Product Categories: | | | Mol File: | 32228-99-2.mol |  |
| | N-PHENYL-4-BIPHENYLAMINE Chemical Properties |
| Melting point | 113 °C | | Boiling point | 125 °C(Press: 0.1 Torr) | | density | 1.111 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 0.73±0.20(Predicted) | | form | Solid | | color | Off-White to Light Brown | | Sensitive | Air Sensitive | | InChI | InChI=1S/C18H15N/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)19-17-9-5-2-6-10-17/h1-14,19H | | InChIKey | YGNUPJXMDOFFDO-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(NC2=CC=CC=C2)C=C1 |
| | N-PHENYL-4-BIPHENYLAMINE Usage And Synthesis |
| Uses | N-Phenyl-4-biphenylamine (cas# 32228-99-2) is a useful reagent for the preparation of heterocyclic compounds for organic electrical devices. |
| | N-PHENYL-4-BIPHENYLAMINE Preparation Products And Raw materials |
|