|
|
| | 4-Hydroxy-5-methyl-2-mercaptopyrimidine Basic information |
| | 4-Hydroxy-5-methyl-2-mercaptopyrimidine Chemical Properties |
| Melting point | 283-286°C | | density | 1.36 | | refractive index | 1.6430 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | pKa 7.71 (Uncertain) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 509mg/L(25 ºC) | | BRN | 120488 | | Stability: | Stable but may be heat or light sensitive. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) | | InChIKey | ZLAQATDNGLKIEV-UHFFFAOYSA-N | | SMILES | C1(=S)NC=C(C)C(=O)N1 | | CAS DataBase Reference | 636-26-0(CAS DataBase Reference) | | NIST Chemistry Reference | 4(1H)-pyrimidinone, 2,3-dihydro-5-methyl-2-thioxo-(636-26-0) | | EPA Substance Registry System | 5-Methyl-2-thiouracil (636-26-0) |
| Provider | Language |
|
ALFA
| English |
| | 4-Hydroxy-5-methyl-2-mercaptopyrimidine Usage And Synthesis |
| Chemical Properties | white crystalline powder | | General Description | White crystalline solid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | 4-Hydroxy-5-methyl-2-mercaptopyrimidine is heat sensitive and may be light sensitive. | | Fire Hazard | Flash point data for 4-Hydroxy-5-methyl-2-mercaptopyrimidine are not available. 4-Hydroxy-5-methyl-2-mercaptopyrimidine is probably combustible. |
| | 4-Hydroxy-5-methyl-2-mercaptopyrimidine Preparation Products And Raw materials |
|