| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Amino-5-bromo-4-fluorobenzoicacid manufacturers
|
| | 2-Amino-5-bromo-4-fluorobenzoicacid Basic information | | Uses |
| Product Name: | 2-Amino-5-bromo-4-fluorobenzoicacid | | Synonyms: | 2-Amino-5-bromo-4-fluorobenzoicacid;5-Bromo-4-fluoroanthranilic acid, 4-Bromo-2-carboxy-5-fluoroaniline;EOS-61436;2-Amino-4-fluoro-5-bromo--benzoic acid;Benzoic acid, 2-amino-5-bromo-4-fluoro-;2-Amino-5-bromo-4-fluorobenzoicacid 98% | | CAS: | 143945-65-7 | | MF: | C7H5BrFNO2 | | MW: | 234.02 | | EINECS: | | | Product Categories: | | | Mol File: | 143945-65-7.mol |  |
| | 2-Amino-5-bromo-4-fluorobenzoicacid Chemical Properties |
| Melting point | 215-217°C | | Boiling point | 343.6±42.0 °C(Predicted) | | density | 1.877±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 4.49±0.10(Predicted) | | color | Off white to brown | | InChI | InChI=1S/C7H5BrFNO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,10H2,(H,11,12) | | InChIKey | RPHQHEBXMAGQKB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Br)=C(F)C=C1N |
| | 2-Amino-5-bromo-4-fluorobenzoicacid Usage And Synthesis |
| Uses | 2-Amino-5-bromo-4-fluorobenzoic acid is an organic intermediate, and literature reports that the brominating agent can be selected from NBS or bromine. | | Synthesis | 2-Amino-5-bromo-4-fluorobenzoic acid can be obtained from 2-amino-4-fluorobenzoic acid after bromination. |
| | 2-Amino-5-bromo-4-fluorobenzoicacid Preparation Products And Raw materials |
|