| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Boc-L-beta-homoasparagine Basic information |
| Product Name: | Boc-L-beta-homoasparagine | | Synonyms: | BOC-BETA-GLN-OH;BOC-BETA-HOASN-OH;BOC-BETA-HOMOASN-OH;BOC-ASN-(C*CH2)OH;(S)-N-BETA-T-BUTOXYCARBONYL-3,5-DIAMINO-5-OXOPENTANOIC ACID;(3S)-3-{[(tert-butoxy)carbonyl]amino}-4-carbamoylbutanoic acid;(S)-3-(BOC-AMINO)PENTANOIC ACID 5-AMIDE;RARECHEM AX KI 1010 | | CAS: | 336182-03-7 | | MF: | C10H18N2O5 | | MW: | 246.26 | | EINECS: | | | Product Categories: | Beta amino acids | | Mol File: | 336182-03-7.mol |  |
| | Boc-L-beta-homoasparagine Chemical Properties |
| Boiling point | 506.9±45.0 °C(Predicted) | | density | 1.220±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.32±0.10(Predicted) | | Major Application | peptide synthesis | | InChI | 1S/C10H18N2O5/c1-10(2,3)17-9(16)12-6(4-7(11)13)5-8(14)15/h6H,4-5H2,1-3H3,(H2,11,13)(H,12,16)(H,14,15)/t6-/m0/s1 | | InChIKey | IUNRBHPDQJCDLT-LURJTMIESA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC(N)=O)CC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-beta-homoasparagine Usage And Synthesis |
| Uses | Boc-l-beta-homoasparagine is used in the preparation of imidazole derivatives and related compounds as kinesin spindle protein (ksp) inhibitors for the treatment of cancer. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-beta-homoasparagine Preparation Products And Raw materials |
|