- Boc-β-hoMoarginine(Tos)
-
- $1.10 / 1g
-
2025-06-25
- CAS:136271-81-3
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
|
| | BOC-L-BETA-HOMOARGININE(TOS) Basic information |
| | BOC-L-BETA-HOMOARGININE(TOS) Chemical Properties |
| density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 4.42±0.10(Predicted) | | color | light yellow | | Major Application | peptide synthesis | | InChIKey | RYHLUZMBVLFVPG-AWEZNQCLSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)NC(=N)NCCC[C@@H](CC(O)=O)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | BOC-L-BETA-HOMOARGININE(TOS) Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis |
| | BOC-L-BETA-HOMOARGININE(TOS) Preparation Products And Raw materials |
|